C19H22ClN7O2 — CID 56553126
5-chloro-N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-methoxy-4-(tetrazol-1-yl)benzamide (PubChem CID 56553126) has the molecular formula C19H22ClN7O2 and a molecular weight of 415.89 g/mol. Its IUPAC name is 5-chloro-N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-methoxy-4-(tetrazol-1-yl)benzamide.
| Compound Name | 5-chloro-N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 56553126 |
| Molecular Formula | C19H22ClN7O2 |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-chloro-N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-methoxy-4-(tetrazol-1-yl)benzamide |
| SMILES | COc1cc(-n2cnnn2)c(Cl)cc1C(=O)Nc1cc(CC2CCCCC2)[nH]n1 |
| InChI | InChI=1S/C19H22ClN7O2/c1-29-17-10-16(27-11-21-25-26-27)15(20)9-14(17)19(28)22-18-8-13(23-24-18)7-12-5-3-2-4-6-12/h8-12H,2-7H2,1H3,(H2,22,23,24,28) |
| InChIKey | VAOAJTDJFWPDHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |