C19H24FN3O3 — CID 126792996
N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-6-fluoro-2,3-dimethoxybenzamide (PubChem CID 126792996) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-6-fluoro-2,3-dimethoxybenzamide.
| Compound Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-6-fluoro-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 126792996 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-6-fluoro-2,3-dimethoxybenzamide |
| SMILES | COc1ccc(F)c(C(=O)Nc2cc(CC3CCCCC3)[nH]n2)c1OC |
| InChI | InChI=1S/C19H24FN3O3/c1-25-15-9-8-14(20)17(18(15)26-2)19(24)21-16-11-13(22-23-16)10-12-6-4-3-5-7-12/h8-9,11-12H,3-7,10H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | BOTTVJULXZKWTG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |