C21H27FN4O2 — CID 56553027
N-[4-[[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]amino]-4-oxobutyl]-4-fluorobenzamide (PubChem CID 56553027) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is N-[4-[[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]amino]-4-oxobutyl]-4-fluorobenzamide.
| Compound Name | N-[4-[[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]amino]-4-oxobutyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 56553027 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[4-[[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]amino]-4-oxobutyl]-4-fluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1)Nc1cc(CC2CCCCC2)[nH]n1 |
| InChI | InChI=1S/C21H27FN4O2/c22-17-10-8-16(9-11-17)21(28)23-12-4-7-20(27)24-19-14-18(25-26-19)13-15-5-2-1-3-6-15/h8-11,14-15H,1-7,12-13H2,(H,23,28)(H2,24,25,26,27) |
| InChIKey | PQPGNSFQFNJISC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|