C17H19F2N3O — CID 56552988
N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2,5-difluorobenzamide (PubChem CID 56552988) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2,5-difluorobenzamide.
| Compound Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 56552988 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2,5-difluorobenzamide |
| SMILES | O=C(Nc1cc(CC2CCCCC2)[nH]n1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2N3O/c18-12-6-7-15(19)14(9-12)17(23)20-16-10-13(21-22-16)8-11-4-2-1-3-5-11/h6-7,9-11H,1-5,8H2,(H2,20,21,22,23) |
| InChIKey | JUZLYWQFNDENTJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |