C19H23F2N3O3 — CID 56553284
N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-3-(difluoromethoxy)-4-methoxybenzamide (PubChem CID 56553284) has the molecular formula C19H23F2N3O3 and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-3-(difluoromethoxy)-4-methoxybenzamide.
| Compound Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-3-(difluoromethoxy)-4-methoxybenzamide |
|---|---|
| PubChem CID | 56553284 |
| Molecular Formula | C19H23F2N3O3 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-3-(difluoromethoxy)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(CC3CCCCC3)[nH]n2)cc1OC(F)F |
| InChI | InChI=1S/C19H23F2N3O3/c1-26-15-8-7-13(10-16(15)27-19(20)21)18(25)22-17-11-14(23-24-17)9-12-5-3-2-4-6-12/h7-8,10-12,19H,2-6,9H2,1H3,(H2,22,23,24,25) |
| InChIKey | CFEKQJLJQHLIQB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |