C20H27N3O3 — CID 56552927
N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 56552927) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 56552927 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[5-(cyclohexylmethyl)-1H-pyrazol-3-yl]-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | COc1cc(C)ccc1OCC(=O)Nc1cc(CC2CCCCC2)[nH]n1 |
| InChI | InChI=1S/C20H27N3O3/c1-14-8-9-17(18(10-14)25-2)26-13-20(24)21-19-12-16(22-23-19)11-15-6-4-3-5-7-15/h8-10,12,15H,3-7,11,13H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | WATYYVIGFIRXNQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |