C16H14BrN5O3 — CID 50776873
5-bromo-2-methoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 50776873) has the molecular formula C16H14BrN5O3 and a molecular weight of 404.22 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50776873 |
| Molecular Formula | C16H14BrN5O3 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 5-bromo-2-methoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(Br)cc1C(=O)Nc1ccc(OC)c(-n2cnnn2)c1 |
| InChI | InChI=1S/C16H14BrN5O3/c1-24-14-5-3-10(17)7-12(14)16(23)19-11-4-6-15(25-2)13(8-11)22-9-18-20-21-22/h3-9H,1-2H3,(H,19,23) |
| InChIKey | ZVTMVLKIYJRDLK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |