C18H19N5O5 — CID 50776858
3,4,5-trimethoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 50776858) has the molecular formula C18H19N5O5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50776858 |
| Molecular Formula | C18H19N5O5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1-n1cnnn1 |
| InChI | InChI=1S/C18H19N5O5/c1-25-14-6-5-12(9-13(14)23-10-19-21-22-23)20-18(24)11-7-15(26-2)17(28-4)16(8-11)27-3/h5-10H,1-4H3,(H,20,24) |
| InChIKey | PILDYROIWRAEQL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |