C16H16N6O3 — CID 154635315
N-[4-(2-methoxyethoxy)-3-(tetrazol-1-yl)phenyl]pyridine-4-carboxamide (PubChem CID 154635315) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is N-[4-(2-methoxyethoxy)-3-(tetrazol-1-yl)phenyl]pyridine-4-carboxamide.
| Compound Name | N-[4-(2-methoxyethoxy)-3-(tetrazol-1-yl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 154635315 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[4-(2-methoxyethoxy)-3-(tetrazol-1-yl)phenyl]pyridine-4-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2ccncc2)cc1-n1cnnn1 |
| InChI | InChI=1S/C16H16N6O3/c1-24-8-9-25-15-3-2-13(10-14(15)22-11-18-20-21-22)19-16(23)12-4-6-17-7-5-12/h2-7,10-11H,8-9H2,1H3,(H,19,23) |
| InChIKey | DEHXYXHACANCTF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|