C21H25N5O4 — CID 46569736
3,4,5-triethoxy-N-[3-methyl-4-(tetrazol-1-yl)phenyl]benzamide (PubChem CID 46569736) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[3-methyl-4-(tetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[3-methyl-4-(tetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46569736 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 3,4,5-triethoxy-N-[3-methyl-4-(tetrazol-1-yl)phenyl]benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(-n3cnnn3)c(C)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H25N5O4/c1-5-28-18-11-15(12-19(29-6-2)20(18)30-7-3)21(27)23-16-8-9-17(14(4)10-16)26-13-22-24-25-26/h8-13H,5-7H2,1-4H3,(H,23,27) |
| InChIKey | PBQGHIROPITBHK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |