C17H16FN5O4 — CID 42571629
5-fluoro-2-(tetrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 42571629) has the molecular formula C17H16FN5O4 and a molecular weight of 373.34 g/mol. Its IUPAC name is 5-fluoro-2-(tetrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 5-fluoro-2-(tetrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 42571629 |
| Molecular Formula | C17H16FN5O4 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-fluoro-2-(tetrazol-1-yl)-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cc(F)ccc2-n2cnnn2)cc(OC)c1OC |
| InChI | InChI=1S/C17H16FN5O4/c1-25-14-7-11(8-15(26-2)16(14)27-3)20-17(24)12-6-10(18)4-5-13(12)23-9-19-21-22-23/h4-9H,1-3H3,(H,20,24) |
| InChIKey | WTCRITJPCTTYCP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |