C11H10FN5O3 — CID 29140117
methyl 2-[[5-fluoro-2-(tetrazol-1-yl)benzoyl]amino]acetate (PubChem CID 29140117) has the molecular formula C11H10FN5O3 and a molecular weight of 279.23 g/mol. Its IUPAC name is methyl 2-[[5-fluoro-2-(tetrazol-1-yl)benzoyl]amino]acetate.
| Compound Name | methyl 2-[[5-fluoro-2-(tetrazol-1-yl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 29140117 |
| Molecular Formula | C11H10FN5O3 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | methyl 2-[[5-fluoro-2-(tetrazol-1-yl)benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C11H10FN5O3/c1-20-10(18)5-13-11(19)8-4-7(12)2-3-9(8)17-6-14-15-16-17/h2-4,6H,5H2,1H3,(H,13,19) |
| InChIKey | GNEVXMKYOXMMMS-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |