C13H10FN5O2 — CID 42534396
5-fluoro-N-(furan-2-ylmethyl)-2-(tetrazol-1-yl)benzamide (PubChem CID 42534396) has the molecular formula C13H10FN5O2 and a molecular weight of 287.25 g/mol. Its IUPAC name is 5-fluoro-N-(furan-2-ylmethyl)-2-(tetrazol-1-yl)benzamide.
| Compound Name | 5-fluoro-N-(furan-2-ylmethyl)-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 42534396 |
| Molecular Formula | C13H10FN5O2 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 5-fluoro-N-(furan-2-ylmethyl)-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCc1ccco1)c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C13H10FN5O2/c14-9-3-4-12(19-8-16-17-18-19)11(6-9)13(20)15-7-10-2-1-5-21-10/h1-6,8H,7H2,(H,15,20) |
| InChIKey | GYKQJPYEGSMZHW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |