C13H16FN5O2 — CID 29131110
5-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-(tetrazol-1-yl)benzamide (PubChem CID 29131110) has the molecular formula C13H16FN5O2 and a molecular weight of 293.30 g/mol. Its IUPAC name is 5-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-(tetrazol-1-yl)benzamide.
| Compound Name | 5-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 29131110 |
| Molecular Formula | C13H16FN5O2 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 5-fluoro-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-2-(tetrazol-1-yl)benzamide |
| SMILES | CC(C)[C@@H](CO)NC(=O)c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C13H16FN5O2/c1-8(2)11(6-20)16-13(21)10-5-9(14)3-4-12(10)19-7-15-17-18-19/h3-5,7-8,11,20H,6H2,1-2H3,(H,16,21)/t11-/m1/s1 |
| InChIKey | BQEODCCNKPTFOK-LLVKDONJSA-N |
| XLogP | 0.55 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |