C12H12FN5O3 — CID 29139683
methyl 3-[[4-fluoro-2-(tetrazol-1-yl)benzoyl]amino]propanoate (PubChem CID 29139683) has the molecular formula C12H12FN5O3 and a molecular weight of 293.26 g/mol. Its IUPAC name is methyl 3-[[4-fluoro-2-(tetrazol-1-yl)benzoyl]amino]propanoate.
| Compound Name | methyl 3-[[4-fluoro-2-(tetrazol-1-yl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 29139683 |
| Molecular Formula | C12H12FN5O3 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | methyl 3-[[4-fluoro-2-(tetrazol-1-yl)benzoyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1ccc(F)cc1-n1cnnn1 |
| InChI | InChI=1S/C12H12FN5O3/c1-21-11(19)4-5-14-12(20)9-3-2-8(13)6-10(9)18-7-15-16-17-18/h2-3,6-7H,4-5H2,1H3,(H,14,20) |
| InChIKey | CXBHLYJRTWDNET-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |