C9H9N5O3S — CID 43623271
methyl 2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]acetate (PubChem CID 43623271) has the molecular formula C9H9N5O3S and a molecular weight of 267.27 g/mol. Its IUPAC name is methyl 2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 43623271 |
| Molecular Formula | C9H9N5O3S |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | methyl 2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C9H9N5O3S/c1-17-7(15)4-10-9(16)8-6(2-3-18-8)14-5-11-12-13-14/h2-3,5H,4H2,1H3,(H,10,16) |
| InChIKey | WBYBFRASSBOFHF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |