C11H15N5O2S — CID 66108564
N-(4-hydroxy-2-methylbutyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 66108564) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylbutyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 66108564 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(4-hydroxy-2-methylbutyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | CC(CCO)CNC(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C11H15N5O2S/c1-8(2-4-17)6-12-11(18)10-9(3-5-19-10)16-7-13-14-15-16/h3,5,7-8,17H,2,4,6H2,1H3,(H,12,18) |
| InChIKey | MVZAKUFCPNMWBL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |