C9H9N5O4S — CID 43357785
3-hydroxy-2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]propanoic acid (PubChem CID 43357785) has the molecular formula C9H9N5O4S and a molecular weight of 283.27 g/mol. Its IUPAC name is 3-hydroxy-2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43357785 |
| Molecular Formula | C9H9N5O4S |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 3-hydroxy-2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC(CO)C(=O)O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C9H9N5O4S/c15-3-5(9(17)18)11-8(16)7-6(1-2-19-7)14-4-10-12-13-14/h1-2,4-5,15H,3H2,(H,11,16)(H,17,18) |
| InChIKey | FKTNUYCPYHYXKU-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |