C13H17N5O2S — CID 62520559
N-[1-(hydroxymethyl)cyclohexyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 62520559) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclohexyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[1-(hydroxymethyl)cyclohexyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 62520559 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclohexyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1(CO)CCCCC1)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C13H17N5O2S/c19-8-13(5-2-1-3-6-13)15-12(20)11-10(4-7-21-11)18-9-14-16-17-18/h4,7,9,19H,1-3,5-6,8H2,(H,15,20) |
| InChIKey | JXUHYWJIEQSPEL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |