C10H11N5OS — CID 47187933
pyrrolidin-1-yl-[3-(tetrazol-1-yl)thiophen-2-yl]methanone (PubChem CID 47187933) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is pyrrolidin-1-yl-[3-(tetrazol-1-yl)thiophen-2-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[3-(tetrazol-1-yl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 47187933 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | pyrrolidin-1-yl-[3-(tetrazol-1-yl)thiophen-2-yl]methanone |
| SMILES | O=C(c1sccc1-n1cnnn1)N1CCCC1 |
| InChI | InChI=1S/C10H11N5OS/c16-10(14-4-1-2-5-14)9-8(3-6-17-9)15-7-11-12-13-15/h3,6-7H,1-2,4-5H2 |
| InChIKey | AFVHYHOKGMZPOU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |