C11H15ClN6OS — CID 119580143
(3-methylpiperazin-1-yl)-[3-(tetrazol-1-yl)thiophen-2-yl]methanone;hydrochloride (PubChem CID 119580143) has the molecular formula C11H15ClN6OS and a molecular weight of 314.80 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-[3-(tetrazol-1-yl)thiophen-2-yl]methanone;hydrochloride.
| Compound Name | (3-methylpiperazin-1-yl)-[3-(tetrazol-1-yl)thiophen-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119580143 |
| Molecular Formula | C11H15ClN6OS |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (3-methylpiperazin-1-yl)-[3-(tetrazol-1-yl)thiophen-2-yl]methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2sccc2-n2cnnn2)CCN1.Cl |
| InChI | InChI=1S/C11H14N6OS.ClH/c1-8-6-16(4-3-12-8)11(18)10-9(2-5-19-10)17-7-13-14-15-17;/h2,5,7-8,12H,3-4,6H2,1H3;1H |
| InChIKey | WLXMAGVBQKOQRR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |