C11H12N6O2S — CID 62898172
4-[3-(tetrazol-1-yl)thiophene-2-carbonyl]-1,4-diazepan-2-one (PubChem CID 62898172) has the molecular formula C11H12N6O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-[3-(tetrazol-1-yl)thiophene-2-carbonyl]-1,4-diazepan-2-one.
| Compound Name | 4-[3-(tetrazol-1-yl)thiophene-2-carbonyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62898172 |
| Molecular Formula | C11H12N6O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[3-(tetrazol-1-yl)thiophene-2-carbonyl]-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)c2sccc2-n2cnnn2)CCCN1 |
| InChI | InChI=1S/C11H12N6O2S/c18-9-6-16(4-1-3-12-9)11(19)10-8(2-5-20-10)17-7-13-14-15-17/h2,5,7H,1,3-4,6H2,(H,12,18) |
| InChIKey | FBPXGNLITNZSGR-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |