C11H7N5O3S2 — CID 43474473
5-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]thiophene-2-carboxylic acid (PubChem CID 43474473) has the molecular formula C11H7N5O3S2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 5-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]thiophene-2-carboxylic acid.
| Compound Name | 5-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43474473 |
| Molecular Formula | C11H7N5O3S2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2sccc2-n2cnnn2)s1 |
| InChI | InChI=1S/C11H7N5O3S2/c17-10(13-8-2-1-7(21-8)11(18)19)9-6(3-4-20-9)16-5-12-14-15-16/h1-5H,(H,13,17)(H,18,19) |
| InChIKey | LDUHUBXHJFQNOM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |