C11H14N6OS — CID 119513985
N-(pyrrolidin-2-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 119513985) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-(pyrrolidin-2-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119513985 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCN1)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C11H14N6OS/c18-11(13-6-8-2-1-4-12-8)10-9(3-5-19-10)17-7-14-15-16-17/h3,5,7-8,12H,1-2,4,6H2,(H,13,18) |
| InChIKey | IOGCBTZDLADKIG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |