C12H19ClN6OS — CID 119668151
N-(1-aminohexan-2-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide;hydrochloride (PubChem CID 119668151) has the molecular formula C12H19ClN6OS and a molecular weight of 330.85 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119668151 |
| Molecular Formula | C12H19ClN6OS |
| Molecular Weight | 330.85 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-(tetrazol-1-yl)thiophene-2-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1sccc1-n1cnnn1.Cl |
| InChI | InChI=1S/C12H18N6OS.ClH/c1-2-3-4-9(7-13)15-12(19)11-10(5-6-20-11)18-8-14-16-17-18;/h5-6,8-9H,2-4,7,13H2,1H3,(H,15,19);1H |
| InChIKey | NXUNUVKLFHRDLT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.85 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |