C12H17N5O2S — CID 61219329
N-butyl-N-(2-hydroxyethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 61219329) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is N-butyl-N-(2-hydroxyethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-butyl-N-(2-hydroxyethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 61219329 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-butyl-N-(2-hydroxyethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | CCCCN(CCO)C(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C12H17N5O2S/c1-2-3-5-16(6-7-18)12(19)11-10(4-8-20-11)17-9-13-14-15-17/h4,8-9,18H,2-3,5-7H2,1H3 |
| InChIKey | MNGDTCPQCWAEEB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |