C12H18N6O2S — CID 103839754
N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 103839754) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103839754 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | CN(C)CC(C)(O)CNC(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C12H18N6O2S/c1-12(20,7-17(2)3)6-13-11(19)10-9(4-5-21-10)18-8-14-15-16-18/h4-5,8,20H,6-7H2,1-3H3,(H,13,19) |
| InChIKey | HKEZHFBUCWBFFD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |