C10H9N7OS — CID 54897166
N-(1H-pyrazol-4-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 54897166) has the molecular formula C10H9N7OS and a molecular weight of 275.30 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-(1H-pyrazol-4-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54897166 |
| Molecular Formula | C10H9N7OS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1cn[nH]c1)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C10H9N7OS/c18-10(11-3-7-4-12-13-5-7)9-8(1-2-19-9)17-6-14-15-16-17/h1-2,4-6H,3H2,(H,11,18)(H,12,13) |
| InChIKey | YZEKTEKNIBWHGU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |