C18H21N7OS — CID 55972123
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 55972123) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55972123 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C18H21N7OS/c26-18(17-15(7-10-27-17)25-13-21-22-23-25)20-12-14-5-6-16(19-11-14)24-8-3-1-2-4-9-24/h5-7,10-11,13H,1-4,8-9,12H2,(H,20,26) |
| InChIKey | GCRAVFMBXGJSKR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |