C21H28N4O4S2 — CID 55749896
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 55749896) has the molecular formula C21H28N4O4S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55749896 |
| Molecular Formula | C21H28N4O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCCCC2)nc1)c1sccc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H28N4O4S2/c26-21(20-18(7-14-30-20)31(27,28)25-10-12-29-13-11-25)23-16-17-5-6-19(22-15-17)24-8-3-1-2-4-9-24/h5-7,14-15H,1-4,8-13,16H2,(H,23,26) |
| InChIKey | CMICUZNVMZFKJD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |