C17H19ClN4O4S — CID 24646619
4-chloro-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-sulfamoylbenzamide (PubChem CID 24646619) has the molecular formula C17H19ClN4O4S and a molecular weight of 410.88 g/mol. Its IUPAC name is 4-chloro-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 24646619 |
| Molecular Formula | C17H19ClN4O4S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-chloro-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NCc2ccc(N3CCOCC3)nc2)ccc1Cl |
| InChI | InChI=1S/C17H19ClN4O4S/c18-14-3-2-13(9-15(14)27(19,24)25)17(23)21-11-12-1-4-16(20-10-12)22-5-7-26-8-6-22/h1-4,9-10H,5-8,11H2,(H,21,23)(H2,19,24,25) |
| InChIKey | BQRNGLUSUYHEMM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |