C10H11N5O4S — CID 79457635
2-[2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]ethoxy]acetic acid (PubChem CID 79457635) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-[2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 79457635 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-[2-[[3-(tetrazol-1-yl)thiophene-2-carbonyl]amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)c1sccc1-n1cnnn1 |
| InChI | InChI=1S/C10H11N5O4S/c16-8(17)5-19-3-2-11-10(18)9-7(1-4-20-9)15-6-12-13-14-15/h1,4,6H,2-3,5H2,(H,11,18)(H,16,17) |
| InChIKey | VTMVMMIMJKCCPC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|