C21H16FN5O2 — CID 29127859
5-fluoro-N-(4-phenylmethoxyphenyl)-2-(tetrazol-1-yl)benzamide (PubChem CID 29127859) has the molecular formula C21H16FN5O2 and a molecular weight of 389.39 g/mol. Its IUPAC name is 5-fluoro-N-(4-phenylmethoxyphenyl)-2-(tetrazol-1-yl)benzamide.
| Compound Name | 5-fluoro-N-(4-phenylmethoxyphenyl)-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 29127859 |
| Molecular Formula | C21H16FN5O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 5-fluoro-N-(4-phenylmethoxyphenyl)-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C21H16FN5O2/c22-16-6-11-20(27-14-23-25-26-27)19(12-16)21(28)24-17-7-9-18(10-8-17)29-13-15-4-2-1-3-5-15/h1-12,14H,13H2,(H,24,28) |
| InChIKey | RBPQKYQHCABGMM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |