C22H37NO4S — CID 3932416
[4-[[butan-2-yl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 3932416) has the molecular formula C22H37NO4S and a molecular weight of 411.61 g/mol. Its IUPAC name is [4-[[butan-2-yl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[butan-2-yl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3932416 |
| Molecular Formula | C22H37NO4S |
| Molecular Weight | 411.61 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [4-[[butan-2-yl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)CC)cc1)C(=O)CC(C)CC(C)(C)C |
| InChI | InChI=1S/C22H37NO4S/c1-8-18(4)23(21(24)14-17(3)15-22(5,6)7)16-19-10-12-20(13-11-19)27-28(25,26)9-2/h10-13,17-18H,8-9,14-16H2,1-7H3 |
| InChIKey | PSTGLHCLWZWFBM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|