C21H28N2O6S — CID 4592003
[3-[[(4-ethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4592003) has the molecular formula C21H28N2O6S and a molecular weight of 436.53 g/mol. Its IUPAC name is [3-[[(4-ethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[(4-ethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4592003 |
| Molecular Formula | C21H28N2O6S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [3-[[(4-ethoxyphenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCOc1ccc(NC(=O)N(CCOC)Cc2cccc(OS(=O)(=O)CC)c2)cc1 |
| InChI | InChI=1S/C21H28N2O6S/c1-4-28-19-11-9-18(10-12-19)22-21(24)23(13-14-27-3)16-17-7-6-8-20(15-17)29-30(25,26)5-2/h6-12,15H,4-5,13-14,16H2,1-3H3,(H,22,24) |
| InChIKey | PKBZPFGAJZOOOJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|