C19H23BrN2O5S — CID 4589374
[3-[[(4-bromophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4589374) has the molecular formula C19H23BrN2O5S and a molecular weight of 471.37 g/mol. Its IUPAC name is [3-[[(4-bromophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[(4-bromophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4589374 |
| Molecular Formula | C19H23BrN2O5S |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [3-[[(4-bromophenyl)carbamoyl-(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(CCOC)C(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H23BrN2O5S/c1-3-28(24,25)27-18-6-4-5-15(13-18)14-22(11-12-26-2)19(23)21-17-9-7-16(20)8-10-17/h4-10,13H,3,11-12,14H2,1-2H3,(H,21,23) |
| InChIKey | AFBINKYRGJXYSD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|