C26H33F3N2O5S — CID 4126275
[5-[[cyclohexylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4126275) has the molecular formula C26H33F3N2O5S and a molecular weight of 542.62 g/mol. Its IUPAC name is [5-[[cyclohexylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [5-[[cyclohexylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4126275 |
| Molecular Formula | C26H33F3N2O5S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [5-[[cyclohexylcarbamoyl(2-methylpropyl)amino]methyl]-2-methoxyphenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | COc1ccc(CN(CC(C)C)C(=O)NC2CCCCC2)cc1OS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H33F3N2O5S/c1-18(2)16-31(25(32)30-21-9-5-4-6-10-21)17-19-12-13-23(35-3)24(14-19)36-37(33,34)22-11-7-8-20(15-22)26(27,28)29/h7-8,11-15,18,21H,4-6,9-10,16-17H2,1-3H3,(H,30,32) |
| InChIKey | HVOVDZKRUJMPNG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|