C25H26O4 — CID 159395535
2-methyl-2-[3-[2-(4-phenylmethoxyphenyl)ethyl]phenoxy]propanoic acid (PubChem CID 159395535) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-methyl-2-[3-[2-(4-phenylmethoxyphenyl)ethyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[3-[2-(4-phenylmethoxyphenyl)ethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 159395535 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methyl-2-[3-[2-(4-phenylmethoxyphenyl)ethyl]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1cccc(CCc2ccc(OCc3ccccc3)cc2)c1)C(=O)O |
| InChI | InChI=1S/C25H26O4/c1-25(2,24(26)27)29-23-10-6-9-20(17-23)12-11-19-13-15-22(16-14-19)28-18-21-7-4-3-5-8-21/h3-10,13-17H,11-12,18H2,1-2H3,(H,26,27) |
| InChIKey | HYQJWDDONLIRRH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |