C18H19ClO6S — CID 70409293
4-[(2-chlorophenyl)methylsulfonyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid (PubChem CID 70409293) has the molecular formula C18H19ClO6S and a molecular weight of 398.86 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylsulfonyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid.
| Compound Name | 4-[(2-chlorophenyl)methylsulfonyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 70409293 |
| Molecular Formula | C18H19ClO6S |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-[(2-chlorophenyl)methylsulfonyl]-2-(4-hydroxyphenoxy)-2-methylbutanoic acid |
| SMILES | CC(CCS(=O)(=O)Cc1ccccc1Cl)(Oc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H19ClO6S/c1-18(17(21)22,25-15-8-6-14(20)7-9-15)10-11-26(23,24)12-13-4-2-3-5-16(13)19/h2-9,20H,10-12H2,1H3,(H,21,22) |
| InChIKey | BOKZCEXNQNLTIA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |