C19H22O5 — CID 70410020
2-(4-hydroxyphenoxy)-2-methyl-4-[(2-methylphenyl)methoxy]butanoic acid (PubChem CID 70410020) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(4-hydroxyphenoxy)-2-methyl-4-[(2-methylphenyl)methoxy]butanoic acid.
| Compound Name | 2-(4-hydroxyphenoxy)-2-methyl-4-[(2-methylphenyl)methoxy]butanoic acid |
|---|---|
| PubChem CID | 70410020 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-(4-hydroxyphenoxy)-2-methyl-4-[(2-methylphenyl)methoxy]butanoic acid |
| SMILES | Cc1ccccc1COCCC(C)(Oc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H22O5/c1-14-5-3-4-6-15(14)13-23-12-11-19(2,18(21)22)24-17-9-7-16(20)8-10-17/h3-10,20H,11-13H2,1-2H3,(H,21,22) |
| InChIKey | ANUABZZTYFNFOQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|