C13H16BrClO3 — CID 70458740
2-bromo-2-chloro-5-[(2-methylphenyl)methoxy]pentanoic acid (PubChem CID 70458740) has the molecular formula C13H16BrClO3 and a molecular weight of 335.62 g/mol. Its IUPAC name is 2-bromo-2-chloro-5-[(2-methylphenyl)methoxy]pentanoic acid.
| Compound Name | 2-bromo-2-chloro-5-[(2-methylphenyl)methoxy]pentanoic acid |
|---|---|
| PubChem CID | 70458740 |
| Molecular Formula | C13H16BrClO3 |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-bromo-2-chloro-5-[(2-methylphenyl)methoxy]pentanoic acid |
| SMILES | Cc1ccccc1COCCCC(Cl)(Br)C(=O)O |
| InChI | InChI=1S/C13H16BrClO3/c1-10-5-2-3-6-11(10)9-18-8-4-7-13(14,15)12(16)17/h2-3,5-6H,4,7-9H2,1H3,(H,16,17) |
| InChIKey | HEXPMGFWJGJYMB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|