C15H18Cl3NO5 — CID 130277258
(2-methylphenyl)methyl 5-amino-4-oxopentanoate;2,2,2-trichloroacetic acid (PubChem CID 130277258) has the molecular formula C15H18Cl3NO5 and a molecular weight of 398.67 g/mol. Its IUPAC name is (2-methylphenyl)methyl 5-amino-4-oxopentanoate;2,2,2-trichloroacetic acid.
| Compound Name | (2-methylphenyl)methyl 5-amino-4-oxopentanoate;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 130277258 |
| Molecular Formula | C15H18Cl3NO5 |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (2-methylphenyl)methyl 5-amino-4-oxopentanoate;2,2,2-trichloroacetic acid |
| SMILES | Cc1ccccc1COC(=O)CCC(=O)CN.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H17NO3.C2HCl3O2/c1-10-4-2-3-5-11(10)9-17-13(16)7-6-12(15)8-14;3-2(4,5)1(6)7/h2-5H,6-9,14H2,1H3;(H,6,7) |
| InChIKey | TZUCVTQZIAIYTL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|