C22H28ClNO4S — CID 4177496
N-[1-(4-butoxyphenyl)ethyl]-3-[(2-chlorophenyl)methylsulfonyl]propanamide (PubChem CID 4177496) has the molecular formula C22H28ClNO4S and a molecular weight of 437.99 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)ethyl]-3-[(2-chlorophenyl)methylsulfonyl]propanamide.
| Compound Name | N-[1-(4-butoxyphenyl)ethyl]-3-[(2-chlorophenyl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 4177496 |
| Molecular Formula | C22H28ClNO4S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[1-(4-butoxyphenyl)ethyl]-3-[(2-chlorophenyl)methylsulfonyl]propanamide |
| SMILES | CCCCOc1ccc(C(C)NC(=O)CCS(=O)(=O)Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C22H28ClNO4S/c1-3-4-14-28-20-11-9-18(10-12-20)17(2)24-22(25)13-15-29(26,27)16-19-7-5-6-8-21(19)23/h5-12,17H,3-4,13-16H2,1-2H3,(H,24,25) |
| InChIKey | SDZDFJKQPGOCAE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|