C12H26N2S — CID 107750268
2,2-dimethyl-5-(3-methylbutan-2-ylsulfanyl)pentanimidamide (PubChem CID 107750268) has the molecular formula C12H26N2S and a molecular weight of 230.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylbutan-2-ylsulfanyl)pentanimidamide.
| Compound Name | 2,2-dimethyl-5-(3-methylbutan-2-ylsulfanyl)pentanimidamide |
|---|---|
| PubChem CID | 107750268 |
| Molecular Formula | C12H26N2S |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylbutan-2-ylsulfanyl)pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCSC(C)C(C)C |
| InChI | InChI=1S/C12H26N2S/c1-9(2)10(3)15-8-6-7-12(4,5)11(13)14/h9-10H,6-8H2,1-5H3,(H3,13,14) |
| InChIKey | AHFVNLAUCPABMA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|