C11H24N2S — CID 107750258
2,2-dimethyl-4-(3-methylbutan-2-ylsulfanyl)butanimidamide (PubChem CID 107750258) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is 2,2-dimethyl-4-(3-methylbutan-2-ylsulfanyl)butanimidamide.
| Compound Name | 2,2-dimethyl-4-(3-methylbutan-2-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 107750258 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | 2,2-dimethyl-4-(3-methylbutan-2-ylsulfanyl)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSC(C)C(C)C |
| InChI | InChI=1S/C11H24N2S/c1-8(2)9(3)14-7-6-11(4,5)10(12)13/h8-9H,6-7H2,1-5H3,(H3,12,13) |
| InChIKey | CLLYEDCJUPORHI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|