C9H15F6NO — CID 102723237
5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpentan-1-amine (PubChem CID 102723237) has the molecular formula C9H15F6NO and a molecular weight of 267.21 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpentan-1-amine.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 102723237 |
| Molecular Formula | C9H15F6NO |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-methylpentan-1-amine |
| SMILES | CNCCCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H15F6NO/c1-16-5-3-2-4-6-17-7(8(10,11)12)9(13,14)15/h7,16H,2-6H2,1H3 |
| InChIKey | QKPKCPGVIMACOW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|