C13H25F3O — CID 146488162
1-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]oxyheptane (PubChem CID 146488162) has the molecular formula C13H25F3O and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]oxyheptane.
| Compound Name | 1-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]oxyheptane |
|---|---|
| PubChem CID | 146488162 |
| Molecular Formula | C13H25F3O |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-[(2R)-1,1,1-trifluoro-3,3-dimethylbutan-2-yl]oxyheptane |
| SMILES | CCCCCCCO[C@H](C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H25F3O/c1-5-6-7-8-9-10-17-11(12(2,3)4)13(14,15)16/h11H,5-10H2,1-4H3/t11-/m1/s1 |
| InChIKey | NBEJQJHORIIOHL-LLVKDONJSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|