C17H33F3O2 — CID 141447005
1-(3,3,3-trifluoro-1-heptoxypropoxy)heptane (PubChem CID 141447005) has the molecular formula C17H33F3O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(3,3,3-trifluoro-1-heptoxypropoxy)heptane.
| Compound Name | 1-(3,3,3-trifluoro-1-heptoxypropoxy)heptane |
|---|---|
| PubChem CID | 141447005 |
| Molecular Formula | C17H33F3O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-(3,3,3-trifluoro-1-heptoxypropoxy)heptane |
| SMILES | CCCCCCCOC(CC(F)(F)F)OCCCCCCC |
| InChI | InChI=1S/C17H33F3O2/c1-3-5-7-9-11-13-21-16(15-17(18,19)20)22-14-12-10-8-6-4-2/h16H,3-15H2,1-2H3 |
| InChIKey | STOTVLHWSXVGNQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|