C16H38ClNO2 — CID 174893450
azane;3,3-dimethyl-1,2-dipentoxybutane;hydrochloride (PubChem CID 174893450) has the molecular formula C16H38ClNO2 and a molecular weight of 311.94 g/mol. Its IUPAC name is azane;3,3-dimethyl-1,2-dipentoxybutane;hydrochloride.
| Compound Name | azane;3,3-dimethyl-1,2-dipentoxybutane;hydrochloride |
|---|---|
| PubChem CID | 174893450 |
| Molecular Formula | C16H38ClNO2 |
| Molecular Weight | 311.94 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | azane;3,3-dimethyl-1,2-dipentoxybutane;hydrochloride |
| SMILES | CCCCCOCC(OCCCCC)C(C)(C)C.Cl.N |
| InChI | InChI=1S/C16H34O2.ClH.H3N/c1-6-8-10-12-17-14-15(16(3,4)5)18-13-11-9-7-2;;/h15H,6-14H2,1-5H3;1H;1H3 |
| InChIKey | YXRRFRLGRWBWPN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.94 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|