C9H15F6NO — CID 102721961
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-2-amine (PubChem CID 102721961) has the molecular formula C9H15F6NO and a molecular weight of 267.21 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-2-amine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-2-amine |
|---|---|
| PubChem CID | 102721961 |
| Molecular Formula | C9H15F6NO |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)hexan-2-amine |
| SMILES | CC(N)CCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H15F6NO/c1-6(16)4-2-3-5-17-7(8(10,11)12)9(13,14)15/h6-7H,2-5,16H2,1H3 |
| InChIKey | CAXGSJGWGLLGHW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|